C32H41F3O — CID 118886119
2,3-difluoro-1-[3-fluoro-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]phenyl]-4-methoxybenzene (PubChem CID 118886119) has the molecular formula C32H41F3O and a molecular weight of 498.67 g/mol. Its IUPAC name is 2,3-difluoro-1-[3-fluoro-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]phenyl]-4-methoxybenzene.
| Compound Name | 2,3-difluoro-1-[3-fluoro-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]phenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 118886119 |
| Molecular Formula | C32H41F3O |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 2,3-difluoro-1-[3-fluoro-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]phenyl]-4-methoxybenzene |
| SMILES | CCCC1CCC(C2CCC(/C=C/CCc3ccc(-c4ccc(OC)c(F)c4F)cc3F)CC2)CC1 |
| InChI | InChI=1S/C32H41F3O/c1-3-6-22-9-13-24(14-10-22)25-15-11-23(12-16-25)7-4-5-8-26-17-18-27(21-29(26)33)28-19-20-30(36-2)32(35)31(28)34/h4,7,17-25H,3,5-6,8-16H2,1-2H3/b7-4+ |
| InChIKey | WYOVNUHNRXZVND-QPJJXVBHSA-N |
| XLogP | 9.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|