C34H46F2O — CID 118886183
2,3-difluoro-1-methoxy-4-[4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene (PubChem CID 118886183) has the molecular formula C34H46F2O and a molecular weight of 508.74 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-[4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene.
| Compound Name | 2,3-difluoro-1-methoxy-4-[4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 118886183 |
| Molecular Formula | C34H46F2O |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-[4-[4-[(E)-4-(4-pentylcyclohexyl)but-3-enyl]cyclohexyl]phenyl]benzene |
| SMILES | CCCCCC1CCC(/C=C/CCC2CCC(c3ccc(-c4ccc(OC)c(F)c4F)cc3)CC2)CC1 |
| InChI | InChI=1S/C34H46F2O/c1-3-4-5-8-25-11-13-26(14-12-25)9-6-7-10-27-15-17-28(18-16-27)29-19-21-30(22-20-29)31-23-24-32(37-2)34(36)33(31)35/h6,9,19-28H,3-5,7-8,10-18H2,1-2H3/b9-6+ |
| InChIKey | GLGPLBRPMIGHRB-RMKNXTFCSA-N |
| XLogP | 10.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|