C28H36F2O — CID 134358629
2,3-difluoro-1-[4-(4-heptylcyclohexyl)phenyl]-4-[(Z)-prop-1-enoxy]benzene (PubChem CID 134358629) has the molecular formula C28H36F2O and a molecular weight of 426.59 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-(4-heptylcyclohexyl)phenyl]-4-[(Z)-prop-1-enoxy]benzene.
| Compound Name | 2,3-difluoro-1-[4-(4-heptylcyclohexyl)phenyl]-4-[(Z)-prop-1-enoxy]benzene |
|---|---|
| PubChem CID | 134358629 |
| Molecular Formula | C28H36F2O |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 2,3-difluoro-1-[4-(4-heptylcyclohexyl)phenyl]-4-[(Z)-prop-1-enoxy]benzene |
| SMILES | C/C=C\Oc1ccc(-c2ccc(C3CCC(CCCCCCC)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C28H36F2O/c1-3-5-6-7-8-9-21-10-12-22(13-11-21)23-14-16-24(17-15-23)25-18-19-26(31-20-4-2)28(30)27(25)29/h4,14-22H,3,5-13H2,1-2H3/b20-4- |
| InChIKey | BWDRIKWSILJLMA-YQLNASGTSA-N |
| XLogP | 9.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|