C30H44F2O — CID 20621725
2,3-difluoro-1-methoxy-4-[4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 20621725) has the molecular formula C30H44F2O and a molecular weight of 458.68 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-[4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 2,3-difluoro-1-methoxy-4-[4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 20621725 |
| Molecular Formula | C30H44F2O |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-[4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CCC/C=C/C1CCC(C2CCC(C3CCC(c4ccc(OC)c(F)c4F)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H44F2O/c1-3-4-5-6-21-7-9-22(10-8-21)23-11-13-24(14-12-23)25-15-17-26(18-16-25)27-19-20-28(33-2)30(32)29(27)31/h5-6,19-26H,3-4,7-18H2,1-2H3/b6-5+ |
| InChIKey | GAZPJSCDJIPKOK-AATRIKPKSA-N |
| XLogP | 9.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|