C17H24F2O — CID 158097848
2,3-difluoro-1-methoxy-4-(4-prop-1-enylcyclohexyl)benzene;methane (PubChem CID 158097848) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-(4-prop-1-enylcyclohexyl)benzene;methane.
| Compound Name | 2,3-difluoro-1-methoxy-4-(4-prop-1-enylcyclohexyl)benzene;methane |
|---|---|
| PubChem CID | 158097848 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-(4-prop-1-enylcyclohexyl)benzene;methane |
| SMILES | C.CC=CC1CCC(c2ccc(OC)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H20F2O.CH4/c1-3-4-11-5-7-12(8-6-11)13-9-10-14(19-2)16(18)15(13)17;/h3-4,9-12H,5-8H2,1-2H3;1H4 |
| InChIKey | FOWPUXCMEMILMG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|