C22H29F2OV2- — CID 59523710
2,3-difluoro-1-methanidyloxy-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene;bis(vanadium) (PubChem CID 59523710) has the molecular formula C22H29F2OV2- and a molecular weight of 449.36 g/mol. Its IUPAC name is 2,3-difluoro-1-methanidyloxy-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene;bis(vanadium).
| Compound Name | 2,3-difluoro-1-methanidyloxy-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene;bis(vanadium) |
|---|---|
| PubChem CID | 59523710 |
| Molecular Formula | C22H29F2OV2- |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2,3-difluoro-1-methanidyloxy-4-[4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexyl]benzene;bis(vanadium) |
| SMILES | [CH2-]Oc1ccc(C2CCC(C3CCC(/C=C/C)CC3)CC2)c(F)c1F.[V].[V] |
| InChI | InChI=1S/C22H29F2O.2V/c1-3-4-15-5-7-16(8-6-15)17-9-11-18(12-10-17)19-13-14-20(25-2)22(24)21(19)23;;/h3-4,13-18H,2,5-12H2,1H3;;/q-1;;/b4-3+;; |
| InChIKey | VZFVHFDGFJYZAV-CZEFNJPISA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|