C40H48F4O — CID 77345552
1-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]benzene (PubChem CID 77345552) has the molecular formula C40H48F4O and a molecular weight of 620.81 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 77345552 |
| Molecular Formula | C40H48F4O |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluoro-4-[4-(4-prop-1-enylcyclohexyl)cyclohexyl]benzene |
| SMILES | CC=CC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCCCCCCC)c(F)c5F)cc4)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C40H48F4O/c1-3-5-6-7-8-26-45-36-25-24-35(39(43)40(36)44)32-20-18-31(19-21-32)34-23-22-33(37(41)38(34)42)30-16-14-29(15-17-30)28-12-10-27(9-4-2)11-13-28/h4,9,18-25,27-30H,3,5-8,10-17,26H2,1-2H3 |
| InChIKey | FKUQWIJQRSLFMC-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|