C35H40F4O2 — CID 77344365
5-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane (PubChem CID 77344365) has the molecular formula C35H40F4O2 and a molecular weight of 568.70 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane |
|---|---|
| PubChem CID | 77344365 |
| Molecular Formula | C35H40F4O2 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]-2-prop-1-enyloxane |
| SMILES | CC=CC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C35H40F4O2/c1-3-5-6-7-8-9-10-22-40-31-21-20-29(34(38)35(31)39)25-14-12-24(13-15-25)28-18-19-30(33(37)32(28)36)26-16-17-27(11-4-2)41-23-26/h4,11-15,18-21,26-27H,3,5-10,16-17,22-23H2,1-2H3 |
| InChIKey | KHCYVNWOQCBXCW-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|