C25H30F2O2 — CID 90823074
2-but-1-enyl-5-[4-(4-butoxy-2,3-difluorophenyl)phenyl]oxane (PubChem CID 90823074) has the molecular formula C25H30F2O2 and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-but-1-enyl-5-[4-(4-butoxy-2,3-difluorophenyl)phenyl]oxane.
| Compound Name | 2-but-1-enyl-5-[4-(4-butoxy-2,3-difluorophenyl)phenyl]oxane |
|---|---|
| PubChem CID | 90823074 |
| Molecular Formula | C25H30F2O2 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-but-1-enyl-5-[4-(4-butoxy-2,3-difluorophenyl)phenyl]oxane |
| SMILES | CCC=CC1CCC(c2ccc(-c3ccc(OCCCC)c(F)c3F)cc2)CO1 |
| InChI | InChI=1S/C25H30F2O2/c1-3-5-7-21-13-12-20(17-29-21)18-8-10-19(11-9-18)22-14-15-23(25(27)24(22)26)28-16-6-4-2/h5,7-11,14-15,20-21H,3-4,6,12-13,16-17H2,1-2H3 |
| InChIKey | DNQAULOXEQBMCD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|