C29H28F4O3 — CID 67737133
5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]-1,3-dioxane (PubChem CID 67737133) has the molecular formula C29H28F4O3 and a molecular weight of 500.53 g/mol. Its IUPAC name is 5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]-1,3-dioxane.
| Compound Name | 5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 67737133 |
| Molecular Formula | C29H28F4O3 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 5-[4-[4-(4-butoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]-2-[(E)-prop-1-enyl]-1,3-dioxane |
| SMILES | C/C=C/C1OCC(c2ccc(-c3ccc(-c4ccc(OCCCC)c(F)c4F)cc3)c(F)c2F)CO1 |
| InChI | InChI=1S/C29H28F4O3/c1-3-5-15-34-24-14-13-22(28(32)29(24)33)19-9-7-18(8-10-19)21-11-12-23(27(31)26(21)30)20-16-35-25(6-4-2)36-17-20/h4,6-14,20,25H,3,5,15-17H2,1-2H3/b6-4+ |
| InChIKey | CFUCZHPJNXAKOL-GQCTYLIASA-N |
| XLogP | 7.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|