C34H40F4O3 — CID 67736986
5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pentyl-1,3-dioxane (PubChem CID 67736986) has the molecular formula C34H40F4O3 and a molecular weight of 572.68 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pentyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 67736986 |
| Molecular Formula | C34H40F4O3 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-pentyl-1,3-dioxane |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(C4COC(CCCCC)OC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C34H40F4O3/c1-3-5-7-8-10-20-39-29-19-18-27(33(37)34(29)38)24-14-12-23(13-15-24)26-16-17-28(32(36)31(26)35)25-21-40-30(41-22-25)11-9-6-4-2/h12-19,25,30H,3-11,20-22H2,1-2H3 |
| InChIKey | CVYCZGGIPFXONV-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|