C33H38F4O2 — CID 67733937
5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-propyloxane (PubChem CID 67733937) has the molecular formula C33H38F4O2 and a molecular weight of 542.66 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-propyloxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-propyloxane |
|---|---|
| PubChem CID | 67733937 |
| Molecular Formula | C33H38F4O2 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2,3-difluorophenyl]-2-propyloxane |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(C4CCC(CCC)OC4)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C33H38F4O2/c1-3-5-6-7-8-20-38-29-19-18-27(32(36)33(29)37)23-12-10-22(11-13-23)26-16-17-28(31(35)30(26)34)24-14-15-25(9-4-2)39-21-24/h10-13,16-19,24-25H,3-9,14-15,20-21H2,1-2H3 |
| InChIKey | TVCHNPXULGAVAS-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|