C16H22F2O2 — CID 20581932
5-(4-ethoxy-2,3-difluorophenyl)-2-propyloxane (PubChem CID 20581932) has the molecular formula C16H22F2O2 and a molecular weight of 284.35 g/mol. Its IUPAC name is 5-(4-ethoxy-2,3-difluorophenyl)-2-propyloxane.
| Compound Name | 5-(4-ethoxy-2,3-difluorophenyl)-2-propyloxane |
|---|---|
| PubChem CID | 20581932 |
| Molecular Formula | C16H22F2O2 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-(4-ethoxy-2,3-difluorophenyl)-2-propyloxane |
| SMILES | CCCC1CCC(c2ccc(OCC)c(F)c2F)CO1 |
| InChI | InChI=1S/C16H22F2O2/c1-3-5-12-7-6-11(10-20-12)13-8-9-14(19-4-2)16(18)15(13)17/h8-9,11-12H,3-7,10H2,1-2H3 |
| InChIKey | XKMJECZMQPSMMH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |