C29H31F3O2 — CID 67733391
5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-2-propyloxane (PubChem CID 67733391) has the molecular formula C29H31F3O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-2-propyloxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-2-propyloxane |
|---|---|
| PubChem CID | 67733391 |
| Molecular Formula | C29H31F3O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]-2-fluorophenyl]-2-propyloxane |
| SMILES | CCCOc1ccc(-c2ccc(-c3ccc(C4CCC(CCC)OC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C29H31F3O2/c1-3-5-23-12-10-22(18-34-23)24-13-11-21(17-26(24)30)19-6-8-20(9-7-19)25-14-15-27(33-16-4-2)29(32)28(25)31/h6-9,11,13-15,17,22-23H,3-5,10,12,16,18H2,1-2H3 |
| InChIKey | HIQWKBCFFVZZOD-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |