C29H29F3O — CID 67730403
1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene (PubChem CID 67730403) has the molecular formula C29H29F3O and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 67730403 |
| Molecular Formula | C29H29F3O |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-propoxybenzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(OCCC)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C29H29F3O/c1-3-17-33-27-16-15-25(28(31)29(27)32)22-11-9-20(10-12-22)23-13-14-24(26(30)18-23)21-7-5-19(4-2)6-8-21/h4,9-16,18-19,21H,2-3,5-8,17H2,1H3 |
| InChIKey | TVHUCBGZBDQJAB-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|