C27H25F3 — CID 67730332
1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 67730332) has the molecular formula C27H25F3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 67730332 |
| Molecular Formula | C27H25F3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[4-[4-(4-ethenylcyclohexyl)-3-fluorophenyl]phenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(C)c(F)c4F)cc3)cc2F)CC1 |
| InChI | InChI=1S/C27H25F3/c1-3-18-5-7-20(8-6-18)23-15-13-22(16-25(23)28)19-9-11-21(12-10-19)24-14-4-17(2)26(29)27(24)30/h3-4,9-16,18,20H,1,5-8H2,2H3 |
| InChIKey | MNUWDWXMYPTJOA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|