C16H24F2 — CID 158570343
1-(4-ethenylcyclohexyl)-2,3-difluoro-4-methylbenzene;methane;molecular hydrogen (PubChem CID 158570343) has the molecular formula C16H24F2 and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-methylbenzene;methane;molecular hydrogen.
| Compound Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-methylbenzene;methane;molecular hydrogen |
|---|---|
| PubChem CID | 158570343 |
| Molecular Formula | C16H24F2 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-2,3-difluoro-4-methylbenzene;methane;molecular hydrogen |
| SMILES | C.C=CC1CCC(c2ccc(C)c(F)c2F)CC1.[H][H] |
| InChI | InChI=1S/C15H18F2.CH4.H2/c1-3-11-5-7-12(8-6-11)13-9-4-10(2)14(16)15(13)17;;/h3-4,9,11-12H,1,5-8H2,2H3;1H4;1H |
| InChIKey | HRZPOGKLBFYDRZ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|