C28H31F3O — CID 88953262
2-[4-[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]cyclohexyl]-2-fluorophenyl]oxirane (PubChem CID 88953262) has the molecular formula C28H31F3O and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]cyclohexyl]-2-fluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]cyclohexyl]-2-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 88953262 |
| Molecular Formula | C28H31F3O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-[4-[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]cyclohexyl]-2-fluorophenyl]oxirane |
| SMILES | C=CC1CCC(c2ccc(C3CCC(c4ccc(C5CO5)c(F)c4)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C28H31F3O/c1-2-17-3-5-19(6-4-17)22-13-14-23(28(31)27(22)30)20-9-7-18(8-10-20)21-11-12-24(25(29)15-21)26-16-32-26/h2,11-15,17-20,26H,1,3-10,16H2 |
| InChIKey | GXSPRQRRQCPHQO-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|