C24H27F3O2 — CID 88589798
1-[2,3-difluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]butan-1-ol (PubChem CID 88589798) has the molecular formula C24H27F3O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]butan-1-ol.
| Compound Name | 1-[2,3-difluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 88589798 |
| Molecular Formula | C24H27F3O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[2,3-difluoro-4-[4-[3-fluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]phenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(C2CCC(c3ccc(C4CO4)c(F)c3)CC2)c(F)c1F |
| InChI | InChI=1S/C24H27F3O2/c1-2-3-21(28)19-11-10-17(23(26)24(19)27)15-6-4-14(5-7-15)16-8-9-18(20(25)12-16)22-13-29-22/h8-12,14-15,21-22,28H,2-7,13H2,1H3 |
| InChIKey | VCDYPWFYJAIUSY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|