C26H30F4O2 — CID 88977785
1-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]-2,3-difluorophenyl]butan-1-ol (PubChem CID 88977785) has the molecular formula C26H30F4O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is 1-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]-2,3-difluorophenyl]butan-1-ol.
| Compound Name | 1-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]-2,3-difluorophenyl]butan-1-ol |
|---|---|
| PubChem CID | 88977785 |
| Molecular Formula | C26H30F4O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[4-[2-[4-[2,3-difluoro-4-(oxiran-2-yl)phenyl]cyclohexyl]ethyl]-2,3-difluorophenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(CCC2CCC(c3ccc(C4CO4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C26H30F4O2/c1-2-3-21(31)19-11-10-17(23(27)25(19)29)9-6-15-4-7-16(8-5-15)18-12-13-20(22-14-32-22)26(30)24(18)28/h10-13,15-16,21-22,31H,2-9,14H2,1H3 |
| InChIKey | VEBCJUYXPTVFHZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|