C29H26F6O2 — CID 88967552
2-[4-[4-[4-[2-(2,3-difluoro-4-methoxyphenyl)ethyl]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88967552) has the molecular formula C29H26F6O2 and a molecular weight of 520.51 g/mol. Its IUPAC name is 2-[4-[4-[4-[2-(2,3-difluoro-4-methoxyphenyl)ethyl]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-[2-(2,3-difluoro-4-methoxyphenyl)ethyl]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88967552 |
| Molecular Formula | C29H26F6O2 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[4-[4-[4-[2-(2,3-difluoro-4-methoxyphenyl)ethyl]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
| SMILES | COc1ccc(CCC2CCC(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C29H26F6O2/c1-36-22-13-8-17(24(30)29(22)35)7-4-15-2-5-16(6-3-15)18-9-10-19(26(32)25(18)31)20-11-12-21(23-14-37-23)28(34)27(20)33/h8-13,15-16,23H,2-7,14H2,1H3 |
| InChIKey | GCSQQABYRZVCJW-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|