C30H28F6O2 — CID 88967666
2-[4-[4-[4-[(2,3-difluoro-4-propylphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane (PubChem CID 88967666) has the molecular formula C30H28F6O2 and a molecular weight of 534.54 g/mol. Its IUPAC name is 2-[4-[4-[4-[(2,3-difluoro-4-propylphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane.
| Compound Name | 2-[4-[4-[4-[(2,3-difluoro-4-propylphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
|---|---|
| PubChem CID | 88967666 |
| Molecular Formula | C30H28F6O2 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-[4-[4-[4-[(2,3-difluoro-4-propylphenyl)methoxy]cyclohexyl]-2,3-difluorophenyl]-2,3-difluorophenyl]oxirane |
| SMILES | CCCc1ccc(COC2CCC(c3ccc(-c4ccc(C5CO5)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C30H28F6O2/c1-2-3-17-4-5-18(26(32)25(17)31)14-37-19-8-6-16(7-9-19)20-10-11-21(28(34)27(20)33)22-12-13-23(24-15-38-24)30(36)29(22)35/h4-5,10-13,16,19,24H,2-3,6-9,14-15H2,1H3 |
| InChIKey | NBVQLKLRGOBXNU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|