C26H32F4O2 — CID 58141762
1-[4-[(2,3-difluoro-4-pentylphenyl)methoxy]cyclohexyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 58141762) has the molecular formula C26H32F4O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-[4-[(2,3-difluoro-4-pentylphenyl)methoxy]cyclohexyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[4-[(2,3-difluoro-4-pentylphenyl)methoxy]cyclohexyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 58141762 |
| Molecular Formula | C26H32F4O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[4-[(2,3-difluoro-4-pentylphenyl)methoxy]cyclohexyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCCCCc1ccc(COC2CCC(c3ccc(OCC)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C26H32F4O2/c1-3-5-6-7-18-8-9-19(24(28)23(18)27)16-32-20-12-10-17(11-13-20)21-14-15-22(31-4-2)26(30)25(21)29/h8-9,14-15,17,20H,3-7,10-13,16H2,1-2H3 |
| InChIKey | CUQCGTGDJSLKQG-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|