C32H34F6O2 — CID 88856456
1-[(2,3-difluoro-4-hexoxyphenyl)methoxy]-4-[4-(2,3-difluoro-4-methylphenyl)cyclohexyl]-2,3-difluorobenzene (PubChem CID 88856456) has the molecular formula C32H34F6O2 and a molecular weight of 564.61 g/mol. Its IUPAC name is 1-[(2,3-difluoro-4-hexoxyphenyl)methoxy]-4-[4-(2,3-difluoro-4-methylphenyl)cyclohexyl]-2,3-difluorobenzene.
| Compound Name | 1-[(2,3-difluoro-4-hexoxyphenyl)methoxy]-4-[4-(2,3-difluoro-4-methylphenyl)cyclohexyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 88856456 |
| Molecular Formula | C32H34F6O2 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 1-[(2,3-difluoro-4-hexoxyphenyl)methoxy]-4-[4-(2,3-difluoro-4-methylphenyl)cyclohexyl]-2,3-difluorobenzene |
| SMILES | CCCCCCOc1ccc(COc2ccc(C3CCC(c4ccc(C)c(F)c4F)CC3)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H34F6O2/c1-3-4-5-6-17-39-25-15-12-22(28(34)31(25)37)18-40-26-16-14-24(30(36)32(26)38)21-10-8-20(9-11-21)23-13-7-19(2)27(33)29(23)35/h7,12-16,20-21H,3-6,8-11,17-18H2,1-2H3 |
| InChIKey | TXXQMLNOEBQYCO-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|