C34H36F6O2 — CID 88856476
1-butoxy-4-[[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]methoxy]-2,3-difluorobenzene (PubChem CID 88856476) has the molecular formula C34H36F6O2 and a molecular weight of 590.65 g/mol. Its IUPAC name is 1-butoxy-4-[[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]methoxy]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]methoxy]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 88856476 |
| Molecular Formula | C34H36F6O2 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 1-butoxy-4-[[4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorophenyl]methoxy]-2,3-difluorobenzene |
| SMILES | C/C=C/CCc1ccc(C2CCC(c3ccc(COc4ccc(OCCCC)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C34H36F6O2/c1-3-5-7-8-23-13-15-25(31(37)29(23)35)21-9-11-22(12-10-21)26-16-14-24(30(36)32(26)38)20-42-28-18-17-27(33(39)34(28)40)41-19-6-4-2/h3,5,13-18,21-22H,4,6-12,19-20H2,1-2H3/b5-3+ |
| InChIKey | BXQSVUQYHWFHGZ-HWKANZROSA-N |
| XLogP | 10.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|