C34H34F6O2 — CID 123521141
1-butoxy-4-[4-[[4-(2,3-difluoro-4-pent-3-enylphenyl)cyclohex-3-en-1-yl]oxymethyl]-2,3-difluorophenyl]-2,3-difluorobenzene (PubChem CID 123521141) has the molecular formula C34H34F6O2 and a molecular weight of 588.63 g/mol. Its IUPAC name is 1-butoxy-4-[4-[[4-(2,3-difluoro-4-pent-3-enylphenyl)cyclohex-3-en-1-yl]oxymethyl]-2,3-difluorophenyl]-2,3-difluorobenzene.
| Compound Name | 1-butoxy-4-[4-[[4-(2,3-difluoro-4-pent-3-enylphenyl)cyclohex-3-en-1-yl]oxymethyl]-2,3-difluorophenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 123521141 |
| Molecular Formula | C34H34F6O2 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | 1-butoxy-4-[4-[[4-(2,3-difluoro-4-pent-3-enylphenyl)cyclohex-3-en-1-yl]oxymethyl]-2,3-difluorophenyl]-2,3-difluorobenzene |
| SMILES | CC=CCCc1ccc(C2=CCC(OCc3ccc(-c4ccc(OCCCC)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C34H34F6O2/c1-3-5-7-8-22-11-15-25(31(37)29(22)35)21-9-13-24(14-10-21)42-20-23-12-16-26(32(38)30(23)36)27-17-18-28(34(40)33(27)39)41-19-6-4-2/h3,5,9,11-12,15-18,24H,4,6-8,10,13-14,19-20H2,1-2H3 |
| InChIKey | WROBPYYINJZRMI-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|