C34H32F6O3 — CID 88856433
[4-(4-butoxy-2,3-difluorophenyl)-2,3-difluorophenyl] 4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohex-3-ene-1-carboxylate (PubChem CID 88856433) has the molecular formula C34H32F6O3 and a molecular weight of 602.62 g/mol. Its IUPAC name is [4-(4-butoxy-2,3-difluorophenyl)-2,3-difluorophenyl] 4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | [4-(4-butoxy-2,3-difluorophenyl)-2,3-difluorophenyl] 4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 88856433 |
| Molecular Formula | C34H32F6O3 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [4-(4-butoxy-2,3-difluorophenyl)-2,3-difluorophenyl] 4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohex-3-ene-1-carboxylate |
| SMILES | C/C=C/CCc1ccc(C2=CCC(C(=O)Oc3ccc(-c4ccc(OCCCC)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C34H32F6O3/c1-3-5-7-8-21-13-14-23(29(36)28(21)35)20-9-11-22(12-10-20)34(41)43-27-18-16-25(31(38)33(27)40)24-15-17-26(32(39)30(24)37)42-19-6-4-2/h3,5,9,13-18,22H,4,6-8,10-12,19H2,1-2H3/b5-3+ |
| InChIKey | SULQURCYIAUGCE-HWKANZROSA-N |
| XLogP | 9.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|