C34H34F6O3 — CID 88856492
(4-butoxy-2,3-difluorophenyl) 4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorobenzoate (PubChem CID 88856492) has the molecular formula C34H34F6O3 and a molecular weight of 604.63 g/mol. Its IUPAC name is (4-butoxy-2,3-difluorophenyl) 4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorobenzoate.
| Compound Name | (4-butoxy-2,3-difluorophenyl) 4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 88856492 |
| Molecular Formula | C34H34F6O3 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | (4-butoxy-2,3-difluorophenyl) 4-[4-[2,3-difluoro-4-[(E)-pent-3-enyl]phenyl]cyclohexyl]-2,3-difluorobenzoate |
| SMILES | C/C=C/CCc1ccc(C2CCC(c3ccc(C(=O)Oc4ccc(OCCCC)c(F)c4F)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C34H34F6O3/c1-3-5-7-8-22-13-14-23(29(36)28(22)35)20-9-11-21(12-10-20)24-15-16-25(31(38)30(24)37)34(41)43-27-18-17-26(32(39)33(27)40)42-19-6-4-2/h3,5,13-18,20-21H,4,6-12,19H2,1-2H3/b5-3+ |
| InChIKey | CPBBYWGPOFKIRX-HWKANZROSA-N |
| XLogP | 9.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|