C32H40F4O4 — CID 89431052
[4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]cyclohexyl] 4-butoxy-2,3-difluorobenzoate (PubChem CID 89431052) has the molecular formula C32H40F4O4 and a molecular weight of 564.66 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]cyclohexyl] 4-butoxy-2,3-difluorobenzoate.
| Compound Name | [4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]cyclohexyl] 4-butoxy-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 89431052 |
| Molecular Formula | C32H40F4O4 |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [4-[2,3-difluoro-4-(4-propoxycyclohexyl)phenyl]cyclohexyl] 4-butoxy-2,3-difluorobenzoate |
| SMILES | CCCCOc1ccc(C(=O)OC2CCC(c3ccc(C4CCC(OCCC)CC4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C32H40F4O4/c1-3-5-19-39-27-17-16-26(30(35)31(27)36)32(37)40-23-12-8-21(9-13-23)25-15-14-24(28(33)29(25)34)20-6-10-22(11-7-20)38-18-4-2/h14-17,20-23H,3-13,18-19H2,1-2H3 |
| InChIKey | QLGHCPXXCNZXDY-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|