C32H41F3O4 — CID 89430293
[4-(4-butoxy-3-fluorophenyl)cyclohexyl] 2,3-difluoro-4-(4-propoxycyclohexyl)benzoate (PubChem CID 89430293) has the molecular formula C32H41F3O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is [4-(4-butoxy-3-fluorophenyl)cyclohexyl] 2,3-difluoro-4-(4-propoxycyclohexyl)benzoate.
| Compound Name | [4-(4-butoxy-3-fluorophenyl)cyclohexyl] 2,3-difluoro-4-(4-propoxycyclohexyl)benzoate |
|---|---|
| PubChem CID | 89430293 |
| Molecular Formula | C32H41F3O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | [4-(4-butoxy-3-fluorophenyl)cyclohexyl] 2,3-difluoro-4-(4-propoxycyclohexyl)benzoate |
| SMILES | CCCCOc1ccc(C2CCC(OC(=O)c3ccc(C4CCC(OCCC)CC4)c(F)c3F)CC2)cc1F |
| InChI | InChI=1S/C32H41F3O4/c1-3-5-19-38-29-17-10-23(20-28(29)33)21-6-13-25(14-7-21)39-32(36)27-16-15-26(30(34)31(27)35)22-8-11-24(12-9-22)37-18-4-2/h10,15-17,20-22,24-25H,3-9,11-14,18-19H2,1-2H3 |
| InChIKey | DLQVZOVDPAOTPB-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|