C30H35F3O3 — CID 88964238
[4-[2,3-difluoro-4-(4-propylcyclohexyl)phenyl]cyclohexyl] 2-fluoro-4-(oxiran-2-yl)benzoate (PubChem CID 88964238) has the molecular formula C30H35F3O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-(4-propylcyclohexyl)phenyl]cyclohexyl] 2-fluoro-4-(oxiran-2-yl)benzoate.
| Compound Name | [4-[2,3-difluoro-4-(4-propylcyclohexyl)phenyl]cyclohexyl] 2-fluoro-4-(oxiran-2-yl)benzoate |
|---|---|
| PubChem CID | 88964238 |
| Molecular Formula | C30H35F3O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [4-[2,3-difluoro-4-(4-propylcyclohexyl)phenyl]cyclohexyl] 2-fluoro-4-(oxiran-2-yl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C3CCC(OC(=O)c4ccc(C5CO5)cc4F)CC3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H35F3O3/c1-2-3-18-4-6-19(7-5-18)23-14-15-24(29(33)28(23)32)20-8-11-22(12-9-20)36-30(34)25-13-10-21(16-26(25)31)27-17-35-27/h10,13-16,18-20,22,27H,2-9,11-12,17H2,1H3 |
| InChIKey | JHVJZVGPKFPSTL-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|