C26H38F2O2 — CID 175685161
(4-fluorocyclohexyl) 2-fluoro-4-(4-heptylcyclohexyl)benzoate (PubChem CID 175685161) has the molecular formula C26H38F2O2 and a molecular weight of 420.58 g/mol. Its IUPAC name is (4-fluorocyclohexyl) 2-fluoro-4-(4-heptylcyclohexyl)benzoate.
| Compound Name | (4-fluorocyclohexyl) 2-fluoro-4-(4-heptylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 175685161 |
| Molecular Formula | C26H38F2O2 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | (4-fluorocyclohexyl) 2-fluoro-4-(4-heptylcyclohexyl)benzoate |
| SMILES | CCCCCCCC1CCC(c2ccc(C(=O)OC3CCC(F)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H38F2O2/c1-2-3-4-5-6-7-19-8-10-20(11-9-19)21-12-17-24(25(28)18-21)26(29)30-23-15-13-22(27)14-16-23/h12,17-20,22-23H,2-11,13-16H2,1H3 |
| InChIKey | IJNWBYAHEAAOAP-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|