C28H42F4O2 — CID 22848705
[(2S)-1,1,1-trifluorodecan-2-yl] 2-fluoro-4-(4-pentylcyclohexyl)benzoate (PubChem CID 22848705) has the molecular formula C28H42F4O2 and a molecular weight of 486.63 g/mol. Its IUPAC name is [(2S)-1,1,1-trifluorodecan-2-yl] 2-fluoro-4-(4-pentylcyclohexyl)benzoate.
| Compound Name | [(2S)-1,1,1-trifluorodecan-2-yl] 2-fluoro-4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 22848705 |
| Molecular Formula | C28H42F4O2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | [(2S)-1,1,1-trifluorodecan-2-yl] 2-fluoro-4-(4-pentylcyclohexyl)benzoate |
| SMILES | CCCCCCCC[C@H](OC(=O)c1ccc(C2CCC(CCCCC)CC2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C28H42F4O2/c1-3-5-7-8-9-11-13-26(28(30,31)32)34-27(33)24-19-18-23(20-25(24)29)22-16-14-21(15-17-22)12-10-6-4-2/h18-22,26H,3-17H2,1-2H3/t21?,22?,26-/m0/s1 |
| InChIKey | KDDRKIVSFMKAAP-LUFKIMSYSA-N |
| XLogP | 9.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|