C23H24F4O3 — CID 71436680
[4-(trifluoromethoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 71436680) has the molecular formula C23H24F4O3 and a molecular weight of 424.43 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 71436680 |
| Molecular Formula | C23H24F4O3 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc(OC(F)(F)F)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H24F4O3/c1-2-3-15-4-6-16(7-5-15)17-8-13-20(21(24)14-17)22(28)29-18-9-11-19(12-10-18)30-23(25,26)27/h8-16H,2-7H2,1H3 |
| InChIKey | VLLHLCMTUHSISQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|