C22H24Cl2O2 — CID 70521539
[4-(4-propylcyclohexyl)phenyl] 2,4-dichlorobenzoate (PubChem CID 70521539) has the molecular formula C22H24Cl2O2 and a molecular weight of 391.34 g/mol. Its IUPAC name is [4-(4-propylcyclohexyl)phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-(4-propylcyclohexyl)phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 70521539 |
| Molecular Formula | C22H24Cl2O2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [4-(4-propylcyclohexyl)phenyl] 2,4-dichlorobenzoate |
| SMILES | CCCC1CCC(c2ccc(OC(=O)c3ccc(Cl)cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C22H24Cl2O2/c1-2-3-15-4-6-16(7-5-15)17-8-11-19(12-9-17)26-22(25)20-13-10-18(23)14-21(20)24/h8-16H,2-7H2,1H3 |
| InChIKey | KQKFOLMJPDLTDZ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|