C35H33ClN2O4 — CID 88640787
[4-(2,2-dicyanoethenyl)phenyl] 2-chloro-4-[4-(4-pentylcyclohexyl)benzoyl]oxybenzoate (PubChem CID 88640787) has the molecular formula C35H33ClN2O4 and a molecular weight of 581.11 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 2-chloro-4-[4-(4-pentylcyclohexyl)benzoyl]oxybenzoate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 2-chloro-4-[4-(4-pentylcyclohexyl)benzoyl]oxybenzoate |
|---|---|
| PubChem CID | 88640787 |
| Molecular Formula | C35H33ClN2O4 |
| Molecular Weight | 581.11 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 2-chloro-4-[4-(4-pentylcyclohexyl)benzoyl]oxybenzoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)Oc3ccc(C(=O)Oc4ccc(C=C(C#N)C#N)cc4)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C35H33ClN2O4/c1-2-3-4-5-24-6-10-27(11-7-24)28-12-14-29(15-13-28)34(39)42-31-18-19-32(33(36)21-31)35(40)41-30-16-8-25(9-17-30)20-26(22-37)23-38/h8-9,12-21,24,27H,2-7,10-11H2,1H3 |
| InChIKey | XYODSSJAZORWTO-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.11 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|