About [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate
[4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate (PubChem CID 3093777) has the molecular formula C24H29ClO2
and a molecular weight of 384.95 g/mol. Its IUPAC name is [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate |
| PubChem CID | 3093777 |
| Molecular Formula | C24H29ClO2 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate |
| SMILES | CCCCCC1CCC(c2ccc(OC(=O)c3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C24H29ClO2/c1-2-3-4-7-18-10-12-19(13-11-18)20-14-16-21(17-15-20)27-24(26)22-8-5-6-9-23(22)25/h5-6,8-9,14-19H,2-4,7,10-13H2,1H3 |
| InChIKey | OBQPRADIAKHMHB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate?
The IUPAC name of [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate (CID 3093777) is [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate.
What is the SMILES notation for [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate?
The canonical SMILES for [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate is CCCCCC1CCC(c2ccc(OC(=O)c3ccccc3Cl)cc2)CC1.
What is the InChIKey of [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate?
The InChIKey is OBQPRADIAKHMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29ClO2/c1-2-3-4-7-18-10-12-19(13-11-18)20-14-16-21(17-15-20)27-24(26)22-8-5-6-9-23(22)25/h5-6,8-9,14-19H,2-4,7,10-13H2,1H3.
What are the key properties of [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate?
[4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate has a molecular weight of 384.95 g/mol, XLogP of 7.41, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-pentylcyclohexyl)phenyl] 2-chlorobenzoate is sourced from PubChem (CID 3093777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).