C27H34O3 — CID 71345427
[4-(4-pentylcyclohexyl)phenyl] 4-prop-2-enoxybenzoate (PubChem CID 71345427) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is [4-(4-pentylcyclohexyl)phenyl] 4-prop-2-enoxybenzoate.
| Compound Name | [4-(4-pentylcyclohexyl)phenyl] 4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 71345427 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | [4-(4-pentylcyclohexyl)phenyl] 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)Oc2ccc(C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H34O3/c1-3-5-6-7-21-8-10-22(11-9-21)23-12-18-26(19-13-23)30-27(28)24-14-16-25(17-15-24)29-20-4-2/h4,12-19,21-22H,2-3,5-11,20H2,1H3 |
| InChIKey | KYAYEXJTRXPWIY-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|