C39H48O5 — CID 156734561
[4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(4-pentylcyclohexyl)phenyl]benzoate (PubChem CID 156734561) has the molecular formula C39H48O5 and a molecular weight of 596.81 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(4-pentylcyclohexyl)phenyl]benzoate.
| Compound Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(4-pentylcyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 156734561 |
| Molecular Formula | C39H48O5 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.35 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[4-(4-pentylcyclohexyl)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(OC(=O)c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H48O5/c1-3-5-8-11-30-12-14-31(15-13-30)32-16-18-33(19-17-32)34-20-22-35(23-21-34)39(41)44-37-26-24-36(25-27-37)42-28-9-6-7-10-29-43-38(40)4-2/h4,16-27,30-31H,2-3,5-15,28-29H2,1H3 |
| InChIKey | XJHNELUWXPCUOZ-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|