About (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate
(4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate (PubChem CID 59695720) has the molecular formula C25H28O3
and a molecular weight of 376.50 g/mol. Its IUPAC name is (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate.
Molecular Properties
| Compound Name | (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate |
| PubChem CID | 59695720 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate |
| SMILES | C=CC(=O)c1ccc(OC(=O)c2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H28O3/c1-3-5-18-6-8-19(9-7-18)20-10-12-22(13-11-20)25(27)28-23-16-14-21(15-17-23)24(26)4-2/h4,10-19H,2-3,5-9H2,1H3 |
| InChIKey | KDOIAJZSUGYXFY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate?
The IUPAC name of (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate (CID 59695720) is (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate.
What is the SMILES notation for (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate?
The canonical SMILES for (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate is C=CC(=O)c1ccc(OC(=O)c2ccc(C3CCC(CCC)CC3)cc2)cc1.
What is the InChIKey of (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate?
The InChIKey is KDOIAJZSUGYXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28O3/c1-3-5-18-6-8-19(9-7-18)20-10-12-22(13-11-20)25(27)28-23-16-14-21(15-17-23)24(26)4-2/h4,10-19H,2-3,5-9H2,1H3.
What are the key properties of (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate?
(4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate has a molecular weight of 376.50 g/mol, XLogP of 6.35, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-prop-2-enoylphenyl) 4-(4-propylcyclohexyl)benzoate is sourced from PubChem (CID 59695720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).