C26H37FO — CID 91356549
1-ethenyl-4-propylcyclohexane;1-[4-(4-fluorocyclohexyl)phenyl]prop-2-en-1-one (PubChem CID 91356549) has the molecular formula C26H37FO and a molecular weight of 384.58 g/mol. Its IUPAC name is 1-ethenyl-4-propylcyclohexane;1-[4-(4-fluorocyclohexyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-ethenyl-4-propylcyclohexane;1-[4-(4-fluorocyclohexyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91356549 |
| Molecular Formula | C26H37FO |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 1-ethenyl-4-propylcyclohexane;1-[4-(4-fluorocyclohexyl)phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(C2CCC(F)CC2)cc1.C=CC1CCC(CCC)CC1 |
| InChI | InChI=1S/C15H17FO.C11H20/c1-2-15(17)13-5-3-11(4-6-13)12-7-9-14(16)10-8-12;1-3-5-11-8-6-10(4-2)7-9-11/h2-6,12,14H,1,7-10H2;4,10-11H,2-3,5-9H2,1H3 |
| InChIKey | ZZDPRYXRLMXWNV-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|