C26H36O — CID 59695799
1-[4-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]prop-2-en-1-one (PubChem CID 59695799) has the molecular formula C26H36O and a molecular weight of 364.57 g/mol. Its IUPAC name is 1-[4-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59695799 |
| Molecular Formula | C26H36O |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | 1-[4-[4-[2-(4-propylcyclohexyl)ethenyl]cyclohexyl]phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1ccc(C2CCC(C=CC3CCC(CCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H36O/c1-3-5-20-6-8-21(9-7-20)10-11-22-12-14-23(15-13-22)24-16-18-25(19-17-24)26(27)4-2/h4,10-11,16-23H,2-3,5-9,12-15H2,1H3 |
| InChIKey | DAHCRDKXQWFIOW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|