C18H24O2 — CID 54142034
4-(4-pent-1-enylcyclohexyl)benzoic acid (PubChem CID 54142034) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-(4-pent-1-enylcyclohexyl)benzoic acid.
| Compound Name | 4-(4-pent-1-enylcyclohexyl)benzoic acid |
|---|---|
| PubChem CID | 54142034 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 4-(4-pent-1-enylcyclohexyl)benzoic acid |
| SMILES | CCCC=CC1CCC(c2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C18H24O2/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h4-5,10-15H,2-3,6-9H2,1H3,(H,19,20) |
| InChIKey | OBTLSPVGQBZPHQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|