C18H25NS2 — CID 22152650
[4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]carbamodithioic acid (PubChem CID 22152650) has the molecular formula C18H25NS2 and a molecular weight of 319.54 g/mol. Its IUPAC name is [4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]carbamodithioic acid.
| Compound Name | [4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]carbamodithioic acid |
|---|---|
| PubChem CID | 22152650 |
| Molecular Formula | C18H25NS2 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]carbamodithioic acid |
| SMILES | CCC/C=C/C1CCC(c2ccc(NC(=S)S)cc2)CC1 |
| InChI | InChI=1S/C18H25NS2/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)19-18(20)21/h4-5,10-15H,2-3,6-9H2,1H3,(H2,19,20,21)/b5-4+ |
| InChIKey | DEIKNHQFJHJXKI-SNAWJCMRSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|