C23H30 — CID 139863616
2-ethyl-6-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene (PubChem CID 139863616) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2-ethyl-6-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene.
| Compound Name | 2-ethyl-6-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene |
|---|---|
| PubChem CID | 139863616 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 2-ethyl-6-[4-[(E)-pent-1-enyl]cyclohexyl]naphthalene |
| SMILES | CCC/C=C/C1CCC(c2ccc3cc(CC)ccc3c2)CC1 |
| InChI | InChI=1S/C23H30/c1-3-5-6-7-19-9-11-20(12-10-19)22-15-14-21-16-18(4-2)8-13-23(21)17-22/h6-8,13-17,19-20H,3-5,9-12H2,1-2H3/b7-6+ |
| InChIKey | AKGOZJKIMYVBKE-VOTSOKGWSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|