C27H40O2 — CID 67787140
1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]-4-propylcyclohexane-1-carboxylic acid (PubChem CID 67787140) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67787140 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]phenyl]-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCC/C=C/C1CCC(c2ccc(C3(C(=O)O)CCC(CCC)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H40O2/c1-3-5-6-8-22-9-11-23(12-10-22)24-13-15-25(16-14-24)27(26(28)29)19-17-21(7-4-2)18-20-27/h6,8,13-16,21-23H,3-5,7,9-12,17-20H2,1-2H3,(H,28,29)/b8-6+ |
| InChIKey | ZIMBNFPCOLACMU-SOFGYWHQSA-N |
| XLogP | 7.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|