C22H26O2 — CID 154428118
2-phenyl-4-(4-propylcyclohexyl)benzoic acid (PubChem CID 154428118) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-phenyl-4-(4-propylcyclohexyl)benzoic acid.
| Compound Name | 2-phenyl-4-(4-propylcyclohexyl)benzoic acid |
|---|---|
| PubChem CID | 154428118 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-phenyl-4-(4-propylcyclohexyl)benzoic acid |
| SMILES | CCCC1CCC(c2ccc(C(=O)O)c(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H26O2/c1-2-6-16-9-11-17(12-10-16)19-13-14-20(22(23)24)21(15-19)18-7-4-3-5-8-18/h3-5,7-8,13-17H,2,6,9-12H2,1H3,(H,23,24) |
| InChIKey | XZVYZIYFXIWHAR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |