C18H29NO2 — CID 70401958
carbamic acid;1-ethyl-4-(4-propylcyclohexyl)benzene (PubChem CID 70401958) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is carbamic acid;1-ethyl-4-(4-propylcyclohexyl)benzene.
| Compound Name | carbamic acid;1-ethyl-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 70401958 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | carbamic acid;1-ethyl-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(CC)cc2)CC1.NC(=O)O |
| InChI | InChI=1S/C17H26.CH3NO2/c1-3-5-15-8-12-17(13-9-15)16-10-6-14(4-2)7-11-16;2-1(3)4/h6-7,10-11,15,17H,3-5,8-9,12-13H2,1-2H3;2H2,(H,3,4) |
| InChIKey | DPJUKCPVLONXIU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |