C22H29N — CID 22420603
4-[[4-(4-propylcyclohexyl)phenyl]methyl]aniline (PubChem CID 22420603) has the molecular formula C22H29N and a molecular weight of 307.48 g/mol. Its IUPAC name is 4-[[4-(4-propylcyclohexyl)phenyl]methyl]aniline.
| Compound Name | 4-[[4-(4-propylcyclohexyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 22420603 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 4-[[4-(4-propylcyclohexyl)phenyl]methyl]aniline |
| SMILES | CCCC1CCC(c2ccc(Cc3ccc(N)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H29N/c1-2-3-17-4-10-20(11-5-17)21-12-6-18(7-13-21)16-19-8-14-22(23)15-9-19/h6-9,12-15,17,20H,2-5,10-11,16,23H2,1H3 |
| InChIKey | KVQNSBWWIRWFAO-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|