C21H32 — CID 71773137
1-(cyclopentylmethyl)-4-(4-propylcyclohexyl)benzene (PubChem CID 71773137) has the molecular formula C21H32 and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-(cyclopentylmethyl)-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 71773137 |
| Molecular Formula | C21H32 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1-(cyclopentylmethyl)-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(CC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H32/c1-2-5-17-8-12-20(13-9-17)21-14-10-19(11-15-21)16-18-6-3-4-7-18/h10-11,14-15,17-18,20H,2-9,12-13,16H2,1H3 |
| InChIKey | ISBJOSKGDWUHKS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |